C30H50N4O4 — CID 68610785
1-N-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 68610785) has the molecular formula C30H50N4O4 and a molecular weight of 530.75 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 68610785 |
| Molecular Formula | C30H50N4O4 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | 1-N-[(2S,3R)-1-cyclohexyl-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)N[C@@H](CC2CCCCC2)[C@H](O)CNCCC(C)C)c1 |
| InChI | InChI=1S/C30H50N4O4/c1-5-14-34(15-6-2)30(38)25-18-23(28(31)36)17-24(19-25)29(37)33-26(16-22-10-8-7-9-11-22)27(35)20-32-13-12-21(3)4/h17-19,21-22,26-27,32,35H,5-16,20H2,1-4H3,(H2,31,36)(H,33,37)/t26-,27+/m0/s1 |
| InChIKey | MMPPYZSOGDAUHP-RRPNLBNLSA-N |
| XLogP | 4.11 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|