C30H44F2N4O5S — CID 68610539
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-5-(methanesulfonamido)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68610539) has the molecular formula C30H44F2N4O5S and a molecular weight of 610.77 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-5-(methanesulfonamido)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-5-(methanesulfonamido)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68610539 |
| Molecular Formula | C30H44F2N4O5S |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(3-methylbutylamino)butan-2-yl]-5-(methanesulfonamido)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(NS(C)(=O)=O)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCCC(C)C)c1 |
| InChI | InChI=1S/C30H44F2N4O5S/c1-6-10-36(11-7-2)30(39)23-15-22(16-26(17-23)35-42(5,40)41)29(38)34-27(28(37)19-33-9-8-20(3)4)14-21-12-24(31)18-25(32)13-21/h12-13,15-18,20,27-28,33,35,37H,6-11,14,19H2,1-5H3,(H,34,38)/t27-,28+/m0/s1 |
| InChIKey | LRVCQUFKACOHHB-WUFINQPMSA-N |
| XLogP | 3.94 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|