C31H43F2N3O4 — CID 68608847
(1R,2R,3S)-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-2-[2-(dipropylamino)-2-oxoethyl]-3-methylcyclopropane-1-carboxamide (PubChem CID 68608847) has the molecular formula C31H43F2N3O4 and a molecular weight of 559.70 g/mol. Its IUPAC name is (1R,2R,3S)-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-2-[2-(dipropylamino)-2-oxoethyl]-3-methylcyclopropane-1-carboxamide.
| Compound Name | (1R,2R,3S)-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-2-[2-(dipropylamino)-2-oxoethyl]-3-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 68608847 |
| Molecular Formula | C31H43F2N3O4 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | (1R,2R,3S)-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-2-[2-(dipropylamino)-2-oxoethyl]-3-methylcyclopropane-1-carboxamide |
| SMILES | CCCN(CCC)C(=O)C[C@@H]1[C@H](C)[C@H]1C(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNCc1cccc(OC)c1 |
| InChI | InChI=1S/C31H43F2N3O4/c1-5-10-36(11-6-2)29(38)17-26-20(3)30(26)31(39)35-27(15-22-12-23(32)16-24(33)13-22)28(37)19-34-18-21-8-7-9-25(14-21)40-4/h7-9,12-14,16,20,26-28,30,34,37H,5-6,10-11,15,17-19H2,1-4H3,(H,35,39)/t20-,26+,27-,28+,30+/m0/s1 |
| InChIKey | RBGZPYMQDCIJFU-ROTIYJFTSA-N |
| XLogP | 4.07 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |