C31H44F2N4O4 — CID 68606831
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-N,3-N-dipropylpiperidine-1,3-dicarboxamide (PubChem CID 68606831) has the molecular formula C31H44F2N4O4 and a molecular weight of 574.71 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-N,3-N-dipropylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-N,3-N-dipropylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68606831 |
| Molecular Formula | C31H44F2N4O4 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-N,3-N-dipropylpiperidine-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1CCCN(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C31H44F2N4O4/c1-4-11-36(12-5-2)30(39)24-9-7-13-37(21-24)31(40)35-28(17-23-14-25(32)18-26(33)15-23)29(38)20-34-19-22-8-6-10-27(16-22)41-3/h6,8,10,14-16,18,24,28-29,34,38H,4-5,7,9,11-13,17,19-21H2,1-3H3,(H,35,40)/t24?,28-,29+/m0/s1 |
| InChIKey | RQUVWTXYZNGEQE-RENJQWLISA-N |
| XLogP | 4.11 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |