C16H21NO3 — CID 68613704
[(1R,2S,5R,9S)-2-(4-hydroxyphenyl)-9-bicyclo[3.3.1]nonanyl]carbamic acid (PubChem CID 68613704) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is [(1R,2S,5R,9S)-2-(4-hydroxyphenyl)-9-bicyclo[3.3.1]nonanyl]carbamic acid.
| Compound Name | [(1R,2S,5R,9S)-2-(4-hydroxyphenyl)-9-bicyclo[3.3.1]nonanyl]carbamic acid |
|---|---|
| PubChem CID | 68613704 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [(1R,2S,5R,9S)-2-(4-hydroxyphenyl)-9-bicyclo[3.3.1]nonanyl]carbamic acid |
| SMILES | O=C(O)N[C@H]1[C@@H]2CCC[C@@H]1[C@@H](c1ccc(O)cc1)CC2 |
| InChI | InChI=1S/C16H21NO3/c18-12-7-4-10(5-8-12)13-9-6-11-2-1-3-14(13)15(11)17-16(19)20/h4-5,7-8,11,13-15,17-18H,1-3,6,9H2,(H,19,20)/t11-,13-,14-,15+/m1/s1 |
| InChIKey | HBLRGUDEWAGGJX-NGFQHRJXSA-N |
| XLogP | 3.32 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |