C25H34O — CID 159970740
4-methylphenol;tricyclo[5.2.1.02,6]decane;1,4-xylene (PubChem CID 159970740) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is 4-methylphenol;tricyclo[5.2.1.02,6]decane;1,4-xylene.
| Compound Name | 4-methylphenol;tricyclo[5.2.1.02,6]decane;1,4-xylene |
|---|---|
| PubChem CID | 159970740 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 4-methylphenol;tricyclo[5.2.1.02,6]decane;1,4-xylene |
| SMILES | C1CC2C3CCC(C3)C2C1.Cc1ccc(C)cc1.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H16.C8H10.C7H8O/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-7-3-5-8(2)6-4-7;1-6-2-4-7(8)5-3-6/h7-10H,1-6H2;3-6H,1-2H3;2-5,8H,1H3 |
| InChIKey | OENAKGILPWLXHW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |