C22H29ClN2O2 — CID 68614511
2-chloro-2-[4-(dimethylamino)-4-phenylcyclohexyl]-N-phenylacetamide;hydrate (PubChem CID 68614511) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-chloro-2-[4-(dimethylamino)-4-phenylcyclohexyl]-N-phenylacetamide;hydrate.
| Compound Name | 2-chloro-2-[4-(dimethylamino)-4-phenylcyclohexyl]-N-phenylacetamide;hydrate |
|---|---|
| PubChem CID | 68614511 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-chloro-2-[4-(dimethylamino)-4-phenylcyclohexyl]-N-phenylacetamide;hydrate |
| SMILES | CN(C)C1(c2ccccc2)CCC(C(Cl)C(=O)Nc2ccccc2)CC1.O |
| InChI | InChI=1S/C22H27ClN2O.H2O/c1-25(2)22(18-9-5-3-6-10-18)15-13-17(14-16-22)20(23)21(26)24-19-11-7-4-8-12-19;/h3-12,17,20H,13-16H2,1-2H3,(H,24,26);1H2 |
| InChIKey | DVFBJQCNCZSZFM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|