C15H16O3P+ — CID 68615340
hydroxy-(2-hydroxy-1,3-diphenylpropan-2-yl)-oxophosphanium (PubChem CID 68615340) has the molecular formula C15H16O3P+ and a molecular weight of 275.26 g/mol. Its IUPAC name is hydroxy-(2-hydroxy-1,3-diphenylpropan-2-yl)-oxophosphanium.
| Compound Name | hydroxy-(2-hydroxy-1,3-diphenylpropan-2-yl)-oxophosphanium |
|---|---|
| PubChem CID | 68615340 |
| Molecular Formula | C15H16O3P+ |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | hydroxy-(2-hydroxy-1,3-diphenylpropan-2-yl)-oxophosphanium |
| SMILES | O=[P+](O)C(O)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H15O3P/c16-15(19(17)18,11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,16H,11-12H2/p+1 |
| InChIKey | FMVDPTLJFCELQU-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|