About dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane
dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane (PubChem CID 159902610) has the molecular formula C18H17IO3P+
and a molecular weight of 439.21 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane |
| PubChem CID | 159902610 |
| Molecular Formula | C18H17IO3P+ |
| Molecular Weight | 439.21 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane |
| SMILES | O=[P+](O)O.c1ccc(I(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15I.HO3P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(2)3/h1-15H;(H-,1,2,3)/p+1 |
| InChIKey | HLUJDICKHLRRII-UHFFFAOYSA-O |
| XLogP | 4.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane?
The IUPAC name of dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane (CID 159902610) is dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane.
What is the SMILES notation for dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane?
The canonical SMILES for dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane is O=[P+](O)O.c1ccc(I(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane?
The InChIKey is HLUJDICKHLRRII-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15I.HO3P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(2)3/h1-15H;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane?
dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane has a molecular weight of 439.21 g/mol, XLogP of 4.73, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;triphenyl-λ3-iodane is sourced from PubChem (CID 159902610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).