C16H22O3P+ — CID 174402873
dihydroxy(oxo)phosphanium;bis(1,4-xylene) (PubChem CID 174402873) has the molecular formula C16H22O3P+ and a molecular weight of 293.32 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;bis(1,4-xylene).
| Compound Name | dihydroxy(oxo)phosphanium;bis(1,4-xylene) |
|---|---|
| PubChem CID | 174402873 |
| Molecular Formula | C16H22O3P+ |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | dihydroxy(oxo)phosphanium;bis(1,4-xylene) |
| SMILES | Cc1ccc(C)cc1.Cc1ccc(C)cc1.O=[P+](O)O |
| InChI | InChI=1S/2C8H10.HO3P/c2*1-7-3-5-8(2)6-4-7;1-4(2)3/h2*3-6H,1-2H3;(H-,1,2,3)/p+1 |
| InChIKey | LHRYVEVBXVGYFZ-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|