C10H12O2 — CID 68616017
2-[(1R,5R)-4-methyl-6-bicyclo[3.2.0]hept-3-enylidene]acetic acid (PubChem CID 68616017) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-[(1R,5R)-4-methyl-6-bicyclo[3.2.0]hept-3-enylidene]acetic acid.
| Compound Name | 2-[(1R,5R)-4-methyl-6-bicyclo[3.2.0]hept-3-enylidene]acetic acid |
|---|---|
| PubChem CID | 68616017 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-[(1R,5R)-4-methyl-6-bicyclo[3.2.0]hept-3-enylidene]acetic acid |
| SMILES | CC1=CC[C@@H]2CC(=CC(=O)O)[C@@H]12 |
| InChI | InChI=1S/C10H12O2/c1-6-2-3-7-4-8(10(6)7)5-9(11)12/h2,5,7,10H,3-4H2,1H3,(H,11,12)/t7-,10+/m1/s1 |
| InChIKey | JWJBTLVSDCPPEY-XCBNKYQSSA-N |
| XLogP | 1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|