C10H11N5 — CID 6861734
(E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-pyridin-2-ylmethanimine (PubChem CID 6861734) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-pyridin-2-ylmethanimine.
| Compound Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 6861734 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-pyridin-2-ylmethanimine |
| SMILES | Cc1nnc(C)n1/N=C/c1ccccn1 |
| InChI | InChI=1S/C10H11N5/c1-8-13-14-9(2)15(8)12-7-10-5-3-4-6-11-10/h3-7H,1-2H3/b12-7+ |
| InChIKey | LADQJXUMXMWBIA-KPKJPENVSA-N |
| XLogP | 1.17 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|