C15H16N6 — CID 6858549
N,N-dimethyl-4-[2-[(E)-1,2,4-triazol-4-yliminomethyl]pyrrol-1-yl]aniline (PubChem CID 6858549) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[(E)-1,2,4-triazol-4-yliminomethyl]pyrrol-1-yl]aniline.
| Compound Name | N,N-dimethyl-4-[2-[(E)-1,2,4-triazol-4-yliminomethyl]pyrrol-1-yl]aniline |
|---|---|
| PubChem CID | 6858549 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N,N-dimethyl-4-[2-[(E)-1,2,4-triazol-4-yliminomethyl]pyrrol-1-yl]aniline |
| SMILES | CN(C)c1ccc(-n2cccc2/C=N/n2cnnc2)cc1 |
| InChI | InChI=1S/C15H16N6/c1-19(2)13-5-7-14(8-6-13)21-9-3-4-15(21)10-18-20-11-16-17-12-20/h3-12H,1-2H3/b18-10+ |
| InChIKey | HSBYKHDWGSSUHB-VCHYOVAHSA-N |
| XLogP | 2.02 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|