C13H11N5 — CID 6891089
(E)-1-(1-phenylpyrrol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6891089) has the molecular formula C13H11N5 and a molecular weight of 237.27 g/mol. Its IUPAC name is (E)-1-(1-phenylpyrrol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(1-phenylpyrrol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6891089 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (E)-1-(1-phenylpyrrol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | C(=N/n1cnnc1)\c1cccn1-c1ccccc1 |
| InChI | InChI=1S/C13H11N5/c1-2-5-12(6-3-1)18-8-4-7-13(18)9-16-17-10-14-15-11-17/h1-11H/b16-9+ |
| InChIKey | WPZGPTBFWCPEAW-CXUHLZMHSA-N |
| XLogP | 1.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|