C16H17N5 — CID 5347203
(E)-1-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5347203) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is (E)-1-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5347203 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (E)-1-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1cccc(-n2c(C)cc(/C=N/n3cnnc3)c2C)c1 |
| InChI | InChI=1S/C16H17N5/c1-12-5-4-6-16(7-12)21-13(2)8-15(14(21)3)9-19-20-10-17-18-11-20/h4-11H,1-3H3/b19-9+ |
| InChIKey | GGPILWYCLXYGIM-DJKKODMXSA-N |
| XLogP | 2.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|