C8H9N5 — CID 6858429
(E)-1-(1-methylpyrrol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6858429) has the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. Its IUPAC name is (E)-1-(1-methylpyrrol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(1-methylpyrrol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6858429 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | (E)-1-(1-methylpyrrol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cn1cccc1/C=N/n1cnnc1 |
| InChI | InChI=1S/C8H9N5/c1-12-4-2-3-8(12)5-11-13-6-9-10-7-13/h2-7H,1H3/b11-5+ |
| InChIKey | MTHLGJBUOHJHKG-VZUCSPMQSA-N |
| XLogP | 0.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|