C13H10BrN5 — CID 6858852
(E)-1-[1-(4-bromophenyl)pyrrol-2-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6858852) has the molecular formula C13H10BrN5 and a molecular weight of 316.16 g/mol. Its IUPAC name is (E)-1-[1-(4-bromophenyl)pyrrol-2-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[1-(4-bromophenyl)pyrrol-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6858852 |
| Molecular Formula | C13H10BrN5 |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | (E)-1-[1-(4-bromophenyl)pyrrol-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Brc1ccc(-n2cccc2/C=N/n2cnnc2)cc1 |
| InChI | InChI=1S/C13H10BrN5/c14-11-3-5-12(6-4-11)19-7-1-2-13(19)8-17-18-9-15-16-10-18/h1-10H/b17-8+ |
| InChIKey | QKLARDNUOGWASM-CAOOACKPSA-N |
| XLogP | 2.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|