C26H34F3N3O3 — CID 68617936
N'-[(2S,3S)-1-[(2,4-dimethylphenyl)methylamino]-3-hydroxyhexan-2-yl]-N-[4-methyl-3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 68617936) has the molecular formula C26H34F3N3O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is N'-[(2S,3S)-1-[(2,4-dimethylphenyl)methylamino]-3-hydroxyhexan-2-yl]-N-[4-methyl-3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N'-[(2S,3S)-1-[(2,4-dimethylphenyl)methylamino]-3-hydroxyhexan-2-yl]-N-[4-methyl-3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 68617936 |
| Molecular Formula | C26H34F3N3O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | N'-[(2S,3S)-1-[(2,4-dimethylphenyl)methylamino]-3-hydroxyhexan-2-yl]-N-[4-methyl-3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CCC[C@H](O)[C@H](CNCc1ccc(C)cc1C)NC(=O)CC(=O)Nc1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H34F3N3O3/c1-5-6-23(33)22(15-30-14-19-9-7-16(2)11-18(19)4)32-25(35)13-24(34)31-20-10-8-17(3)21(12-20)26(27,28)29/h7-12,22-23,30,33H,5-6,13-15H2,1-4H3,(H,31,34)(H,32,35)/t22-,23-/m0/s1 |
| InChIKey | IYXKITJKYJTLAE-GOTSBHOMSA-N |
| XLogP | 4.39 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|