C22H30N4S — CID 68630809
1-[2-(1H-indol-3-ylmethylamino)ethyl]-N,N-dimethyl-4-thiophen-2-ylpiperidin-4-amine (PubChem CID 68630809) has the molecular formula C22H30N4S and a molecular weight of 382.58 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-ylmethylamino)ethyl]-N,N-dimethyl-4-thiophen-2-ylpiperidin-4-amine.
| Compound Name | 1-[2-(1H-indol-3-ylmethylamino)ethyl]-N,N-dimethyl-4-thiophen-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 68630809 |
| Molecular Formula | C22H30N4S |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-[2-(1H-indol-3-ylmethylamino)ethyl]-N,N-dimethyl-4-thiophen-2-ylpiperidin-4-amine |
| SMILES | CN(C)C1(c2cccs2)CCN(CCNCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H30N4S/c1-25(2)22(21-8-5-15-27-21)9-12-26(13-10-22)14-11-23-16-18-17-24-20-7-4-3-6-19(18)20/h3-8,15,17,23-24H,9-14,16H2,1-2H3 |
| InChIKey | BPRZKJJPHKRYFH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|