C28H29F3IN3O4 — CID 68631434
ethyl 2-[3-[2-[2-iodo-1-(pyridin-3-ylmethylcarbamoylamino)propyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetate (PubChem CID 68631434) has the molecular formula C28H29F3IN3O4 and a molecular weight of 655.45 g/mol. Its IUPAC name is ethyl 2-[3-[2-[2-iodo-1-(pyridin-3-ylmethylcarbamoylamino)propyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[3-[2-[2-iodo-1-(pyridin-3-ylmethylcarbamoylamino)propyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 68631434 |
| Molecular Formula | C28H29F3IN3O4 |
| Molecular Weight | 655.45 g/mol |
| Exact Mass | 655.12 |
| IUPAC Name | ethyl 2-[3-[2-[2-iodo-1-(pyridin-3-ylmethylcarbamoylamino)propyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(-c2ccc(C(F)(F)F)cc2C(NC(=O)NCc2cccnc2)C(C)I)c1 |
| InChI | InChI=1S/C28H29F3IN3O4/c1-4-39-25(36)13-18-7-10-24(38-3)22(12-18)21-9-8-20(28(29,30)31)14-23(21)26(17(2)32)35-27(37)34-16-19-6-5-11-33-15-19/h5-12,14-15,17,26H,4,13,16H2,1-3H3,(H2,34,35,37) |
| InChIKey | QRHZPFGEIYEEIZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|