C16H20N2O2 — CID 68636010
3-[5-(4-methoxyphenyl)-1H-pyrrol-3-yl]-N,N-dimethylpropanamide (PubChem CID 68636010) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)-1H-pyrrol-3-yl]-N,N-dimethylpropanamide.
| Compound Name | 3-[5-(4-methoxyphenyl)-1H-pyrrol-3-yl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 68636010 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)-1H-pyrrol-3-yl]-N,N-dimethylpropanamide |
| SMILES | COc1ccc(-c2cc(CCC(=O)N(C)C)c[nH]2)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-18(2)16(19)9-4-12-10-15(17-11-12)13-5-7-14(20-3)8-6-13/h5-8,10-11,17H,4,9H2,1-3H3 |
| InChIKey | YCWWXZMSEKGFOI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |