C39H49F2NO13 — CID 68638322
tert-butyl 2-[4-[2,7-difluoro-9-hydroxy-3,6-bis(2-methoxyethoxymethoxy)xanthen-9-yl]-2-hydroxy-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate (PubChem CID 68638322) has the molecular formula C39H49F2NO13 and a molecular weight of 777.81 g/mol. Its IUPAC name is tert-butyl 2-[4-[2,7-difluoro-9-hydroxy-3,6-bis(2-methoxyethoxymethoxy)xanthen-9-yl]-2-hydroxy-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate.
| Compound Name | tert-butyl 2-[4-[2,7-difluoro-9-hydroxy-3,6-bis(2-methoxyethoxymethoxy)xanthen-9-yl]-2-hydroxy-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate |
|---|---|
| PubChem CID | 68638322 |
| Molecular Formula | C39H49F2NO13 |
| Molecular Weight | 777.81 g/mol |
| Exact Mass | 777.32 |
| IUPAC Name | tert-butyl 2-[4-[2,7-difluoro-9-hydroxy-3,6-bis(2-methoxyethoxymethoxy)xanthen-9-yl]-2-hydroxy-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate |
| SMILES | COCCOCOc1cc2c(cc1F)C(O)(c1ccc(N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)c(O)c1)c1cc(F)c(OCOCCOC)cc1O2 |
| InChI | InChI=1S/C39H49F2NO13/c1-37(2,3)54-35(44)20-42(21-36(45)55-38(4,5)6)29-10-9-24(15-30(29)43)39(46)25-16-27(40)33(51-22-49-13-11-47-7)18-31(25)53-32-19-34(28(41)17-26(32)39)52-23-50-14-12-48-8/h9-10,15-19,43,46H,11-14,20-23H2,1-8H3 |
| InChIKey | VJCXJFHQHVXJPK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.81 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|