C46H55F2NO13 — CID 68637794
tert-butyl 2-[4-[2,7-difluoro-9-hydroxy-3,6-bis(2-methoxyethoxymethoxy)xanthen-9-yl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-phenylmethoxyanilino]acetate (PubChem CID 68637794) has the molecular formula C46H55F2NO13 and a molecular weight of 867.94 g/mol. Its IUPAC name is tert-butyl 2-[4-[2,7-difluoro-9-hydroxy-3,6-bis(2-methoxyethoxymethoxy)xanthen-9-yl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-phenylmethoxyanilino]acetate.
| Compound Name | tert-butyl 2-[4-[2,7-difluoro-9-hydroxy-3,6-bis(2-methoxyethoxymethoxy)xanthen-9-yl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-phenylmethoxyanilino]acetate |
|---|---|
| PubChem CID | 68637794 |
| Molecular Formula | C46H55F2NO13 |
| Molecular Weight | 867.94 g/mol |
| Exact Mass | 867.36 |
| IUPAC Name | tert-butyl 2-[4-[2,7-difluoro-9-hydroxy-3,6-bis(2-methoxyethoxymethoxy)xanthen-9-yl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-phenylmethoxyanilino]acetate |
| SMILES | COCCOCOc1cc2c(cc1F)C(O)(c1ccc(N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)c(OCc3ccccc3)c1)c1cc(F)c(OCOCCOC)cc1O2 |
| InChI | InChI=1S/C46H55F2NO13/c1-44(2,3)61-42(50)25-49(26-43(51)62-45(4,5)6)36-15-14-31(20-41(36)57-27-30-12-10-9-11-13-30)46(52)32-21-34(47)39(58-28-55-18-16-53-7)23-37(32)60-38-24-40(35(48)22-33(38)46)59-29-56-19-17-54-8/h9-15,20-24,52H,16-19,25-29H2,1-8H3 |
| InChIKey | OVIQPGFJTNUJBX-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.94 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|