C30H51NO7Si — CID 140905040
tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-(2-prop-2-enoxyethoxy)anilino]acetate (PubChem CID 140905040) has the molecular formula C30H51NO7Si and a molecular weight of 565.82 g/mol. Its IUPAC name is tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-(2-prop-2-enoxyethoxy)anilino]acetate.
| Compound Name | tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-(2-prop-2-enoxyethoxy)anilino]acetate |
|---|---|
| PubChem CID | 140905040 |
| Molecular Formula | C30H51NO7Si |
| Molecular Weight | 565.82 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-(2-prop-2-enoxyethoxy)anilino]acetate |
| SMILES | C=CCOCCOc1ccc(CO[Si](C)(C)C(C)(C)C)cc1N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H51NO7Si/c1-13-16-34-17-18-35-25-15-14-23(22-36-39(11,12)30(8,9)10)19-24(25)31(20-26(32)37-28(2,3)4)21-27(33)38-29(5,6)7/h13-15,19H,1,16-18,20-22H2,2-12H3 |
| InChIKey | DKFUYISYIOBKLR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.82 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|