About ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate
ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate (PubChem CID 123651815) has the molecular formula C26H40O5Si
and a molecular weight of 460.69 g/mol. Its IUPAC name is ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate |
| PubChem CID | 123651815 |
| Molecular Formula | C26H40O5Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C#Cc1ccc(CO[Si](C)(C)C(C)(C)C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40O5Si/c1-24(2,3)30-22(27)21(23(28)31-25(4,5)6)17-16-19-12-14-20(15-13-19)18-29-32(10,11)26(7,8)9/h12-15,21H,18H2,1-11H3 |
| InChIKey | OSLNBJKVPJEOKX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate?
The IUPAC name of ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate (CID 123651815) is ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate.
What is the SMILES notation for ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate?
The canonical SMILES for ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate is CC(C)(C)OC(=O)C(C#Cc1ccc(CO[Si](C)(C)C(C)(C)C)cc1)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate?
The InChIKey is OSLNBJKVPJEOKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40O5Si/c1-24(2,3)30-22(27)21(23(28)31-25(4,5)6)17-16-19-12-14-20(15-13-19)18-29-32(10,11)26(7,8)9/h12-15,21H,18H2,1-11H3.
What are the key properties of ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate?
ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate has a molecular weight of 460.69 g/mol, XLogP of 5.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]propanedioate is sourced from PubChem (CID 123651815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).