C28H28O5 — CID 11487603
tert-butyl 2-[5-methyl-2-oxo-3-(2-phenylmethoxyphenyl)-1-benzofuran-3-yl]acetate (PubChem CID 11487603) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl 2-[5-methyl-2-oxo-3-(2-phenylmethoxyphenyl)-1-benzofuran-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-methyl-2-oxo-3-(2-phenylmethoxyphenyl)-1-benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 11487603 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | tert-butyl 2-[5-methyl-2-oxo-3-(2-phenylmethoxyphenyl)-1-benzofuran-3-yl]acetate |
| SMILES | Cc1ccc2c(c1)C(CC(=O)OC(C)(C)C)(c1ccccc1OCc1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C28H28O5/c1-19-14-15-24-22(16-19)28(26(30)32-24,17-25(29)33-27(2,3)4)21-12-8-9-13-23(21)31-18-20-10-6-5-7-11-20/h5-16H,17-18H2,1-4H3 |
| InChIKey | DKAQGOVNMSWMDM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|