C17H28O — CID 68638389
3,3-dimethyl-4-(1,2,2-trimethylcyclopent-3-en-1-yl)hepta-1,6-dien-4-ol (PubChem CID 68638389) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 3,3-dimethyl-4-(1,2,2-trimethylcyclopent-3-en-1-yl)hepta-1,6-dien-4-ol.
| Compound Name | 3,3-dimethyl-4-(1,2,2-trimethylcyclopent-3-en-1-yl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 68638389 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 3,3-dimethyl-4-(1,2,2-trimethylcyclopent-3-en-1-yl)hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(C(C)(C)C=C)C1(C)CC=CC1(C)C |
| InChI | InChI=1S/C17H28O/c1-8-11-17(18,14(3,4)9-2)16(7)13-10-12-15(16,5)6/h8-10,12,18H,1-2,11,13H2,3-7H3 |
| InChIKey | IAAKTHNFVDCCGP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|