C13H20O — CID 11171530
1-(1,5,5-trimethylcyclohex-2-en-1-yl)but-3-en-2-one (PubChem CID 11171530) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-(1,5,5-trimethylcyclohex-2-en-1-yl)but-3-en-2-one.
| Compound Name | 1-(1,5,5-trimethylcyclohex-2-en-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 11171530 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-(1,5,5-trimethylcyclohex-2-en-1-yl)but-3-en-2-one |
| SMILES | C=CC(=O)CC1(C)C=CCC(C)(C)C1 |
| InChI | InChI=1S/C13H20O/c1-5-11(14)9-13(4)8-6-7-12(2,3)10-13/h5-6,8H,1,7,9-10H2,2-4H3 |
| InChIKey | FSTMCWIXRXJLBV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|