About acetaldehyde;4,4-dimethylcyclopentene;ethane
acetaldehyde;4,4-dimethylcyclopentene;ethane (PubChem CID 144700874) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is acetaldehyde;4,4-dimethylcyclopentene;ethane.
Molecular Properties
| Compound Name | acetaldehyde;4,4-dimethylcyclopentene;ethane |
| PubChem CID | 144700874 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | acetaldehyde;4,4-dimethylcyclopentene;ethane |
| SMILES | CC.CC1(C)CC=CC1.CC=O |
| InChI | InChI=1S/C7H12.C2H4O.C2H6/c1-7(2)5-3-4-6-7;1-2-3;1-2/h3-4H,5-6H2,1-2H3;2H,1H3;1-2H3 |
| InChIKey | XJXMNPBPYYKJNB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;4,4-dimethylcyclopentene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;4,4-dimethylcyclopentene;ethane?
The IUPAC name of acetaldehyde;4,4-dimethylcyclopentene;ethane (CID 144700874) is acetaldehyde;4,4-dimethylcyclopentene;ethane.
What is the SMILES notation for acetaldehyde;4,4-dimethylcyclopentene;ethane?
The canonical SMILES for acetaldehyde;4,4-dimethylcyclopentene;ethane is CC.CC1(C)CC=CC1.CC=O.
What is the InChIKey of acetaldehyde;4,4-dimethylcyclopentene;ethane?
The InChIKey is XJXMNPBPYYKJNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C2H4O.C2H6/c1-7(2)5-3-4-6-7;1-2-3;1-2/h3-4H,5-6H2,1-2H3;2H,1H3;1-2H3.
What are the key properties of acetaldehyde;4,4-dimethylcyclopentene;ethane?
acetaldehyde;4,4-dimethylcyclopentene;ethane has a molecular weight of 170.30 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;4,4-dimethylcyclopentene;ethane is sourced from PubChem (CID 144700874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).