C8H16 — CID 143166820
4,4-dimethylcyclopentene;methane (PubChem CID 143166820) has the molecular formula C8H16 and a molecular weight of 112.22 g/mol. Its IUPAC name is 4,4-dimethylcyclopentene;methane.
| Compound Name | 4,4-dimethylcyclopentene;methane |
|---|---|
| PubChem CID | 143166820 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | 4,4-dimethylcyclopentene;methane |
| SMILES | C.CC1(C)CC=CC1 |
| InChI | InChI=1S/C7H12.CH4/c1-7(2)5-3-4-6-7;/h3-4H,5-6H2,1-2H3;1H4 |
| InChIKey | IBWCTLWSSSMOIL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|