C14H24N2 — CID 22787987
(5E,9E)-3,3,12,12-tetramethyl-1,2-diazacyclododeca-1,5,9-triene (PubChem CID 22787987) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (5E,9E)-3,3,12,12-tetramethyl-1,2-diazacyclododeca-1,5,9-triene.
| Compound Name | (5E,9E)-3,3,12,12-tetramethyl-1,2-diazacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 22787987 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (5E,9E)-3,3,12,12-tetramethyl-1,2-diazacyclododeca-1,5,9-triene |
| SMILES | CC1(C)C/C=C/CC/C=C/CC(C)(C)/N=N/1 |
| InChI | InChI=1S/C14H24N2/c1-13(2)11-9-7-5-6-8-10-12-14(3,4)16-15-13/h7-10H,5-6,11-12H2,1-4H3/b9-7+,10-8+,16-15+ |
| InChIKey | SQWNDFLAMFGWKK-UXPOPVFASA-N |
| XLogP | 4.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|