C7H12Se — CID 101002388
6,6-dimethyl-2,5-dihydroselenopyran (PubChem CID 101002388) has the molecular formula C7H12Se and a molecular weight of 175.13 g/mol. Its IUPAC name is 6,6-dimethyl-2,5-dihydroselenopyran.
| Compound Name | 6,6-dimethyl-2,5-dihydroselenopyran |
|---|---|
| PubChem CID | 101002388 |
| Molecular Formula | C7H12Se |
| Molecular Weight | 175.13 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | 6,6-dimethyl-2,5-dihydroselenopyran |
| SMILES | CC1(C)CC=CC[Se]1 |
| InChI | InChI=1S/C7H12Se/c1-7(2)5-3-4-6-8-7/h3-4H,5-6H2,1-2H3 |
| InChIKey | XDKISYHEOPBAGT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.13 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|