C18H24O2 — CID 11471275
5-[(1S,2R,3R,4R)-1,4-dimethyl-3-prop-2-enoyl-2-bicyclo[2.2.2]oct-5-enyl]pent-1-en-3-one (PubChem CID 11471275) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 5-[(1S,2R,3R,4R)-1,4-dimethyl-3-prop-2-enoyl-2-bicyclo[2.2.2]oct-5-enyl]pent-1-en-3-one.
| Compound Name | 5-[(1S,2R,3R,4R)-1,4-dimethyl-3-prop-2-enoyl-2-bicyclo[2.2.2]oct-5-enyl]pent-1-en-3-one |
|---|---|
| PubChem CID | 11471275 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 5-[(1S,2R,3R,4R)-1,4-dimethyl-3-prop-2-enoyl-2-bicyclo[2.2.2]oct-5-enyl]pent-1-en-3-one |
| SMILES | C=CC(=O)CC[C@@H]1[C@@H](C(=O)C=C)[C@@]2(C)C=C[C@]1(C)CC2 |
| InChI | InChI=1S/C18H24O2/c1-5-13(19)7-8-14-16(15(20)6-2)18(4)11-9-17(14,3)10-12-18/h5-6,9,11,14,16H,1-2,7-8,10,12H2,3-4H3/t14-,16+,17-,18+/m1/s1 |
| InChIKey | NPWGVUHZSGVLHI-SPUZQDLCSA-N |
| XLogP | 3.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|