C19H26O2 — CID 68643101
(2E)-2-[(2-hexoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 68643101) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (2E)-2-[(2-hexoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E)-2-[(2-hexoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 68643101 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (2E)-2-[(2-hexoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | CCCCCCOc1ccccc1/C=C1\CCCCC1=O |
| InChI | InChI=1S/C19H26O2/c1-2-3-4-9-14-21-19-13-8-6-11-17(19)15-16-10-5-7-12-18(16)20/h6,8,11,13,15H,2-5,7,9-10,12,14H2,1H3/b16-15+ |
| InChIKey | GVTPMSIKWAALEF-FOCLMDBBSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|