C26H21F3N4OS — CID 68643754
3-benzyl-6-methyl-5-[1-methyl-2-[3-(trifluoromethyl)phenyl]benzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one (PubChem CID 68643754) has the molecular formula C26H21F3N4OS and a molecular weight of 494.54 g/mol. Its IUPAC name is 3-benzyl-6-methyl-5-[1-methyl-2-[3-(trifluoromethyl)phenyl]benzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one.
| Compound Name | 3-benzyl-6-methyl-5-[1-methyl-2-[3-(trifluoromethyl)phenyl]benzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 68643754 |
| Molecular Formula | C26H21F3N4OS |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 3-benzyl-6-methyl-5-[1-methyl-2-[3-(trifluoromethyl)phenyl]benzimidazol-5-yl]-6H-1,3,4-thiadiazin-2-one |
| SMILES | CC1SC(=O)N(Cc2ccccc2)N=C1c1ccc2c(c1)nc(-c1cccc(C(F)(F)F)c1)n2C |
| InChI | InChI=1S/C26H21F3N4OS/c1-16-23(31-33(25(34)35-16)15-17-7-4-3-5-8-17)18-11-12-22-21(14-18)30-24(32(22)2)19-9-6-10-20(13-19)26(27,28)29/h3-14,16H,15H2,1-2H3 |
| InChIKey | YFJVNPQLRBOAFQ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|