C16H18N4O3 — CID 68644431
5-[(4-carbamimidoylphenyl)methoxy]-4-(hydroxymethyl)-6-methylpyridine-3-carboxamide (PubChem CID 68644431) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 5-[(4-carbamimidoylphenyl)methoxy]-4-(hydroxymethyl)-6-methylpyridine-3-carboxamide.
| Compound Name | 5-[(4-carbamimidoylphenyl)methoxy]-4-(hydroxymethyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 68644431 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5-[(4-carbamimidoylphenyl)methoxy]-4-(hydroxymethyl)-6-methylpyridine-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(COc2c(C)ncc(C(N)=O)c2CO)cc1 |
| InChI | InChI=1S/C16H18N4O3/c1-9-14(13(7-21)12(6-20-9)16(19)22)23-8-10-2-4-11(5-3-10)15(17)18/h2-6,21H,7-8H2,1H3,(H3,17,18)(H2,19,22) |
| InChIKey | HLIWSTRVGNRZAH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 135.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|