C21H32ClN7O3 — CID 68645199
3-chloro-6-[[[5-(1-hydroxybutan-2-ylamino)-1,3-di(propan-2-yl)-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]benzene-1,2-diol (PubChem CID 68645199) has the molecular formula C21H32ClN7O3 and a molecular weight of 465.99 g/mol. Its IUPAC name is 3-chloro-6-[[[5-(1-hydroxybutan-2-ylamino)-1,3-di(propan-2-yl)-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]benzene-1,2-diol.
| Compound Name | 3-chloro-6-[[[5-(1-hydroxybutan-2-ylamino)-1,3-di(propan-2-yl)-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 68645199 |
| Molecular Formula | C21H32ClN7O3 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-chloro-6-[[[5-(1-hydroxybutan-2-ylamino)-1,3-di(propan-2-yl)-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]benzene-1,2-diol |
| SMILES | CCC(CO)Nc1nc(NCc2ccc(Cl)c(O)c2O)c2c(n1)N(C(C)C)NN2C(C)C |
| InChI | InChI=1S/C21H32ClN7O3/c1-6-14(10-30)24-21-25-19(23-9-13-7-8-15(22)18(32)17(13)31)16-20(26-21)29(12(4)5)27-28(16)11(2)3/h7-8,11-12,14,27,30-32H,6,9-10H2,1-5H3,(H2,23,24,25,26) |
| InChIKey | IFTWBLPGQJROAP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|