About 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid
4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid (PubChem CID 68648386) has the molecular formula C15H18BFN2O3
and a molecular weight of 304.13 g/mol. Its IUPAC name is 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid.
Molecular Properties
| Compound Name | 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid |
| PubChem CID | 68648386 |
| Molecular Formula | C15H18BFN2O3 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid |
| SMILES | Fc1cccc(N2CCOCC2)n1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C9H11FN2O.C6H7BO2/c10-8-2-1-3-9(11-8)12-4-6-13-7-5-12;8-7(9)6-4-2-1-3-5-6/h1-3H,4-7H2;1-5,8-9H |
| InChIKey | VJQWAZUENSFXAN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid?
The IUPAC name of 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid (CID 68648386) is 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid.
What is the SMILES notation for 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid?
The canonical SMILES for 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid is Fc1cccc(N2CCOCC2)n1.OB(O)c1ccccc1.
What is the InChIKey of 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid?
The InChIKey is VJQWAZUENSFXAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O.C6H7BO2/c10-8-2-1-3-9(11-8)12-4-6-13-7-5-12;8-7(9)6-4-2-1-3-5-6/h1-3H,4-7H2;1-5,8-9H.
What are the key properties of 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid?
4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid has a molecular weight of 304.13 g/mol, XLogP of 0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluoro-2-pyridinyl)morpholine;phenylboronic acid is sourced from PubChem (CID 68648386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).