C8H15F3N2O2S — CID 68662508
thian-4-ylmethylhydrazine;2,2,2-trifluoroacetic acid (PubChem CID 68662508) has the molecular formula C8H15F3N2O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is thian-4-ylmethylhydrazine;2,2,2-trifluoroacetic acid.
| Compound Name | thian-4-ylmethylhydrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68662508 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | thian-4-ylmethylhydrazine;2,2,2-trifluoroacetic acid |
| SMILES | NNCC1CCSCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H14N2S.C2HF3O2/c7-8-5-6-1-3-9-4-2-6;3-2(4,5)1(6)7/h6,8H,1-5,7H2;(H,6,7) |
| InChIKey | WSBDAXXXIYEDKR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|