C26H34F2N2O4 — CID 68663151
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[2-(1,3-dioxolan-2-yl)ethylamino]-3-hydroxybutan-2-yl]-2-(4-propan-2-ylphenyl)acetamide (PubChem CID 68663151) has the molecular formula C26H34F2N2O4 and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[2-(1,3-dioxolan-2-yl)ethylamino]-3-hydroxybutan-2-yl]-2-(4-propan-2-ylphenyl)acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[2-(1,3-dioxolan-2-yl)ethylamino]-3-hydroxybutan-2-yl]-2-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 68663151 |
| Molecular Formula | C26H34F2N2O4 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[2-(1,3-dioxolan-2-yl)ethylamino]-3-hydroxybutan-2-yl]-2-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(CC(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCCC2OCCO2)cc1 |
| InChI | InChI=1S/C26H34F2N2O4/c1-17(2)20-5-3-18(4-6-20)14-25(32)30-23(13-19-11-21(27)15-22(28)12-19)24(31)16-29-8-7-26-33-9-10-34-26/h3-6,11-12,15,17,23-24,26,29,31H,7-10,13-14,16H2,1-2H3,(H,30,32)/t23-,24+/m0/s1 |
| InChIKey | DHEZLUTVWMVTPG-BJKOFHAPSA-N |
| XLogP | 3.07 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|