C60H90O5 — CID 68663213
1-methoxy-4-[3-[[4-(4-methoxyphenyl)phenyl]methoxy]-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]benzene (PubChem CID 68663213) has the molecular formula C60H90O5 and a molecular weight of 891.37 g/mol. Its IUPAC name is 1-methoxy-4-[3-[[4-(4-methoxyphenyl)phenyl]methoxy]-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]benzene.
| Compound Name | 1-methoxy-4-[3-[[4-(4-methoxyphenyl)phenyl]methoxy]-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]benzene |
|---|---|
| PubChem CID | 68663213 |
| Molecular Formula | C60H90O5 |
| Molecular Weight | 891.37 g/mol |
| Exact Mass | 890.68 |
| IUPAC Name | 1-methoxy-4-[3-[[4-(4-methoxyphenyl)phenyl]methoxy]-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]benzene |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(COCc1ccc(-c2ccc(OC)cc2)cc1)C(OCCCCCCCC/C=C\C/C=C\CCCCC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C60H90O5/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-49-64-59(52-63-51-53-37-39-54(40-38-53)55-41-45-57(61-3)46-42-55)60(56-43-47-58(62-4)48-44-56)65-50-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,37-48,59-60H,5-12,17-18,23-36,49-52H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | MJMXOVWDTPNOIK-KWXKLSQISA-N |
| XLogP | 17.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.37 |
| LogP ≤ 5 | 17.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|