C17H9F3N2O3S — CID 68663716
5-[3-[3-(trifluoromethoxy)phenyl]-1-benzofuran-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 68663716) has the molecular formula C17H9F3N2O3S and a molecular weight of 378.33 g/mol. Its IUPAC name is 5-[3-[3-(trifluoromethoxy)phenyl]-1-benzofuran-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[3-[3-(trifluoromethoxy)phenyl]-1-benzofuran-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 68663716 |
| Molecular Formula | C17H9F3N2O3S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 5-[3-[3-(trifluoromethoxy)phenyl]-1-benzofuran-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | FC(F)(F)Oc1cccc(-c2coc3ccc(-c4n[nH]c(=S)o4)cc23)c1 |
| InChI | InChI=1S/C17H9F3N2O3S/c18-17(19,20)25-11-3-1-2-9(6-11)13-8-23-14-5-4-10(7-12(13)14)15-21-22-16(26)24-15/h1-8H,(H,22,26) |
| InChIKey | GTAVPKKAMRFZRS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|