C34H39ClN4O2 — CID 68663826
N-[4-[3-(2-benzylpiperazine-1-carbonyl)-2-methylpyrrol-1-yl]phenyl]-5-phenylpentanamide;hydrochloride (PubChem CID 68663826) has the molecular formula C34H39ClN4O2 and a molecular weight of 571.17 g/mol. Its IUPAC name is N-[4-[3-(2-benzylpiperazine-1-carbonyl)-2-methylpyrrol-1-yl]phenyl]-5-phenylpentanamide;hydrochloride.
| Compound Name | N-[4-[3-(2-benzylpiperazine-1-carbonyl)-2-methylpyrrol-1-yl]phenyl]-5-phenylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 68663826 |
| Molecular Formula | C34H39ClN4O2 |
| Molecular Weight | 571.17 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | N-[4-[3-(2-benzylpiperazine-1-carbonyl)-2-methylpyrrol-1-yl]phenyl]-5-phenylpentanamide;hydrochloride |
| SMILES | Cc1c(C(=O)N2CCNCC2Cc2ccccc2)ccn1-c1ccc(NC(=O)CCCCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C34H38N4O2.ClH/c1-26-32(34(40)38-23-21-35-25-31(38)24-28-13-6-3-7-14-28)20-22-37(26)30-18-16-29(17-19-30)36-33(39)15-9-8-12-27-10-4-2-5-11-27;/h2-7,10-11,13-14,16-20,22,31,35H,8-9,12,15,21,23-25H2,1H3,(H,36,39);1H |
| InChIKey | UYTLHVFJQOJWGU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.17 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|