C39H40N4O2 — CID 59324639
N-[4-[3-(2-benzylpiperazine-1-carbonyl)-2-phenylpyrrol-1-yl]phenyl]-5-phenylpentanamide (PubChem CID 59324639) has the molecular formula C39H40N4O2 and a molecular weight of 596.78 g/mol. Its IUPAC name is N-[4-[3-(2-benzylpiperazine-1-carbonyl)-2-phenylpyrrol-1-yl]phenyl]-5-phenylpentanamide.
| Compound Name | N-[4-[3-(2-benzylpiperazine-1-carbonyl)-2-phenylpyrrol-1-yl]phenyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 59324639 |
| Molecular Formula | C39H40N4O2 |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | N-[4-[3-(2-benzylpiperazine-1-carbonyl)-2-phenylpyrrol-1-yl]phenyl]-5-phenylpentanamide |
| SMILES | O=C(CCCCc1ccccc1)Nc1ccc(-n2ccc(C(=O)N3CCNCC3Cc3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C39H40N4O2/c44-37(19-11-10-14-30-12-4-1-5-13-30)41-33-20-22-34(23-21-33)42-26-24-36(38(42)32-17-8-3-9-18-32)39(45)43-27-25-40-29-35(43)28-31-15-6-2-7-16-31/h1-9,12-13,15-18,20-24,26,35,40H,10-11,14,19,25,27-29H2,(H,41,44) |
| InChIKey | XSTRRFDCSASVOK-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|