C21H30N4O3 — CID 68664172
tert-butyl 4-(aminomethyl)-4-[1H-indol-2-yl(methyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 68664172) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is tert-butyl 4-(aminomethyl)-4-[1H-indol-2-yl(methyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(aminomethyl)-4-[1H-indol-2-yl(methyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68664172 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | tert-butyl 4-(aminomethyl)-4-[1H-indol-2-yl(methyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CN(C(=O)C1(CN)CCN(C(=O)OC(C)(C)C)CC1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H30N4O3/c1-20(2,3)28-19(27)25-11-9-21(14-22,10-12-25)18(26)24(4)17-13-15-7-5-6-8-16(15)23-17/h5-8,13,23H,9-12,14,22H2,1-4H3 |
| InChIKey | UJIVQPPVPGKODZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |