C25H33N5O2 — CID 68670178
formic acid;2-[3-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]phenyl]-1H-benzimidazole (PubChem CID 68670178) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is formic acid;2-[3-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]phenyl]-1H-benzimidazole.
| Compound Name | formic acid;2-[3-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 68670178 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | formic acid;2-[3-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]phenyl]-1H-benzimidazole |
| SMILES | CN1CCC(CN2CCN(c3cccc(-c4nc5ccccc5[nH]4)c3)CC2)CC1.O=CO |
| InChI | InChI=1S/C24H31N5.CH2O2/c1-27-11-9-19(10-12-27)18-28-13-15-29(16-14-28)21-6-4-5-20(17-21)24-25-22-7-2-3-8-23(22)26-24;2-1-3/h2-8,17,19H,9-16,18H2,1H3,(H,25,26);1H,(H,2,3) |
| InChIKey | VLWPSLHEPVGOSX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|