C15H19ClO3 — CID 68673792
1-(4-chlorophenyl)-2-ethyl-2-hydroxycyclohexane-1-carboxylic acid (PubChem CID 68673792) has the molecular formula C15H19ClO3 and a molecular weight of 282.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-ethyl-2-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 1-(4-chlorophenyl)-2-ethyl-2-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 68673792 |
| Molecular Formula | C15H19ClO3 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(4-chlorophenyl)-2-ethyl-2-hydroxycyclohexane-1-carboxylic acid |
| SMILES | CCC1(O)CCCCC1(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClO3/c1-2-14(19)9-3-4-10-15(14,13(17)18)11-5-7-12(16)8-6-11/h5-8,19H,2-4,9-10H2,1H3,(H,17,18) |
| InChIKey | AMBWERUXTWKLHQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |