C17H24ClNO — CID 139928433
2-[1-(4-chlorophenyl)cyclopentyl]-N,N-diethylacetamide (PubChem CID 139928433) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)cyclopentyl]-N,N-diethylacetamide.
| Compound Name | 2-[1-(4-chlorophenyl)cyclopentyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 139928433 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-[1-(4-chlorophenyl)cyclopentyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CC1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C17H24ClNO/c1-3-19(4-2)16(20)13-17(11-5-6-12-17)14-7-9-15(18)10-8-14/h7-10H,3-6,11-13H2,1-2H3 |
| InChIKey | GNSZKMYZRXHHCY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |