About 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride
1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride (PubChem CID 165361754) has the molecular formula C16H25Cl2N
and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride |
| PubChem CID | 165361754 |
| Molecular Formula | C16H25Cl2N |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride |
| SMILES | CCN(CC)C1(c2ccc(Cl)cc2)CCCCC1.Cl |
| InChI | InChI=1S/C16H24ClN.ClH/c1-3-18(4-2)16(12-6-5-7-13-16)14-8-10-15(17)11-9-14;/h8-11H,3-7,12-13H2,1-2H3;1H |
| InChIKey | AYQQLEBIYWQONE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride?
The IUPAC name of 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride (CID 165361754) is 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride.
What is the SMILES notation for 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride?
The canonical SMILES for 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride is CCN(CC)C1(c2ccc(Cl)cc2)CCCCC1.Cl.
What is the InChIKey of 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride?
The InChIKey is AYQQLEBIYWQONE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24ClN.ClH/c1-3-18(4-2)16(12-6-5-7-13-16)14-8-10-15(17)11-9-14;/h8-11H,3-7,12-13H2,1-2H3;1H.
What are the key properties of 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride?
1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride has a molecular weight of 302.29 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-N,N-diethylcyclohexan-1-amine;hydrochloride is sourced from PubChem (CID 165361754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).