C20H30ClN — CID 70506296
N-but-2-enyl-1-(4-chlorophenyl)-3-methyl-N-propylcyclohexan-1-amine (PubChem CID 70506296) has the molecular formula C20H30ClN and a molecular weight of 319.92 g/mol. Its IUPAC name is N-but-2-enyl-1-(4-chlorophenyl)-3-methyl-N-propylcyclohexan-1-amine.
| Compound Name | N-but-2-enyl-1-(4-chlorophenyl)-3-methyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 70506296 |
| Molecular Formula | C20H30ClN |
| Molecular Weight | 319.92 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-but-2-enyl-1-(4-chlorophenyl)-3-methyl-N-propylcyclohexan-1-amine |
| SMILES | CC=CCN(CCC)C1(c2ccc(Cl)cc2)CCCC(C)C1 |
| InChI | InChI=1S/C20H30ClN/c1-4-6-15-22(14-5-2)20(13-7-8-17(3)16-20)18-9-11-19(21)12-10-18/h4,6,9-12,17H,5,7-8,13-16H2,1-3H3 |
| InChIKey | GIVVVWDUGGKSLC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.92 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|